BD8026631
Methyl 2-fluorobenzoate , 98% , 394-35-4
CAS NO.:394-35-4
Empirical Formula: C8H7FO2
Molecular Weight: 154.14
MDL number: MFCD00017913
EINECS: 206-894-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 10g | RMB32.80 | In Stock |
|
| 25g | RMB42.40 | In Stock |
|
| 100g | RMB152.00 | In Stock |
|
| 500g | RMB641.60 | In Stock |
|
| 1000g | RMB1165.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 93°C |
| Boiling point: | 109-110 °C/35 mmHg (lit.) |
| Density | 1.21 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 201 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| Specific Gravity | 1.210 |
| color | Colorless to Almost colorless |
| BRN | 1862493 |
| InChI | InChI=1S/C8H7FO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
| InChIKey | QAFJIJWLEBLXHH-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=CC=C1F |
| CAS DataBase Reference | 394-35-4(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 2-fluoro-, methyl ester (394-35-4) |
Description and Uses
Methyl 2-fluorobenzoate may be used to synthesize 2-fluoro-α-methylstyrene and 2-fluorophenyldiphenylmethanol.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319 |
| Precautionary statements | P210e-P280a-P305+P351+P338-P403+P235-P501a |
| PPE | Eyeshields, Gloves |
| Hazard Codes | T,Xi |
| Risk Statements | 36/38 |
| Safety Statements | 26-36/37/39-37 |
| RIDADR | UN3272 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29163990 |
| Storage Class | 10 - Combustible liquids |







