BD8029231
Methyl 3-amino-5,6-dichloropyrazine-2-carboxylate , 97% , 1458-18-0
CAS NO.：1458-18-0
Empirical Formula: C6H5Cl2N3O2
Molecular Weight: 222.03
MDL number: MFCD00010431
EINECS: 215-947-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB33.60 | In Stock |
|
| 1g | RMB81.60 | In Stock |
|
| 5g | RMB336.00 | In Stock |
|
| 10g | RMB636.00 | In Stock |
|
| 25g | RMB1272.80 | In Stock |
|
| 100g | RMB4184.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 227-230 °C |
| Boiling point: | 357.3±37.0 °C(Predicted) |
| Density | 1.586 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Dichloromethane (Slightly), DMSO (Slightly) |
| form | Powder |
| pka | -2.74±0.10(Predicted) |
| color | Light brown to red-brown |
| InChI | InChI=1S/C6H5Cl2N3O2/c1-13-6(12)2-5(9)11-4(8)3(7)10-2/h1H3,(H2,9,11) |
| InChIKey | USYMCUGEGUFUBI-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=NC(Cl)=C(Cl)N=C1N |
| LogP | 1.9-2.2 at 35℃ |
| CAS DataBase Reference | 1458-18-0(CAS DataBase Reference) |
Description and Uses
3-Amino-5,6-dichloro-2-pyrazinecarboxylic Acid Methyl Ester, is used for the preparation of 2-Amidino analogs of glycine-Amiloride (A578700) conjugates, acting as inhibitors of the protease urokinase plasminogen activator (uPA), a promising anticancer targets. Dyes and metabolites.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H332-H335 |
| Precautionary statements | P261-P264-P271-P302+P352-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/22-20 |
| Safety Statements | 36/37/39-26-22-45 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HS Code | 29339980 |
