BD8324531
3-Amino-6-chloropyrazine-2-carboxylic acid , 95% , 2727-13-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB38.40 | In Stock |
|
| 1g | RMB79.20 | In Stock |
|
| 5g | RMB383.20 | In Stock |
|
| 10g | RMB723.20 | In Stock |
|
| 25g | RMB1757.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 178.5-179.5 °C |
| Boiling point: | 402.2±45.0 °C(Predicted) |
| Density | 1.690 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 3.28±0.10(Predicted) |
| Appearance | Light yellow to yellow Solid |
| InChI | InChI=1S/C5H4ClN3O2/c6-2-1-8-4(7)3(9-2)5(10)11/h1H,(H2,7,8)(H,10,11) |
| InChIKey | TZEPSUWOCPVNMM-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=NC(Cl)=CN=C1N |
Description and Uses
3-amino-6-chloropyrazine-2-carboxylic acid is a useful pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
