BD8041431
Methyl 6-methoxy-1H-indole-2-carboxylate , 97% , 98081-83-5
Synonym(s):
2-Methoxycarbonyl-6-methoxyindole;6-Methoxyindole-2-carboxylic acid methyl ester
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB41.60 | In Stock |
|
| 1g | RMB96.80 | In Stock |
|
| 5g | RMB288.80 | In Stock |
|
| 10g | RMB521.60 | In Stock |
|
| 25g | RMB1142.40 | In Stock |
|
| 100g | RMB3517.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 117-119 °C(lit.) |
| Boiling point: | 370.1±22.0 °C(Predicted) |
| Density | 1.253±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Powder |
| pka | 15.20±0.30(Predicted) |
| color | White to beige |
| InChI | InChI=1S/C11H11NO3/c1-14-8-4-3-7-5-10(11(13)15-2)12-9(7)6-8/h3-6,12H,1-2H3 |
| InChIKey | OPUUCOLVBDQWEY-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC(OC)=C2)C=C1C(OC)=O |
| CAS DataBase Reference | 98081-83-5(CAS DataBase Reference) |
Description and Uses
Methyl 6-methoxy-2-indolecarboxylate is suitable for use in the production of dyes by Escherichia coli expressing naphthalene dioxygenase (NDO) and toluene dioxygenase (TDO). It is also suitable for use in the production of dyes by Escherichia coli expressing multicomponent phenol hydroxylase (mPH) from Pseudomonas sp. strains KL33 and KL28.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339980 |
