BD8063131
3-(3,4,5-Trimethoxyphenyl)propanoic acid , 97% , 25173-72-2
Synonym(s):
3,4,5-Trimethoxyhydrocinnamic acid
CAS NO.：25173-72-2
Empirical Formula: C12H16O5
Molecular Weight: 240.25
MDL number: MFCD00002775
EINECS: 246-706-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB27.20 | In Stock |
|
| 5g | RMB105.60 | In Stock |
|
| 10g | RMB172.80 | In Stock |
|
| 25g | RMB417.60 | In Stock |
|
| 100g | RMB1492.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 100-104 °C (lit.) |
| Boiling point: | 373℃ |
| Density | 1.169 |
| refractive index | 1.5140 (estimate) |
| Flash point: | 140℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | methanol: 0.1 g/mL, clear |
| pka | 4.70±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to almost white |
| BRN | 1471912 |
| InChI | InChI=1S/C12H16O5/c1-15-9-6-8(4-5-11(13)14)7-10(16-2)12(9)17-3/h6-7H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | ZCYXGVJUZBKJAI-UHFFFAOYSA-N |
| SMILES | C1(CCC(O)=O)=CC(OC)=C(OC)C(OC)=C1 |
| CAS DataBase Reference | 25173-72-2(CAS DataBase Reference) |
Description and Uses
3-(3,4,5-Trimethoxyphenyl)propanoic acid is found in herbs and spices. 3-(3,4,5-Trimethoxyphenyl)propanoic acid is a constituent of Piper longum (long pepper) and Piper retrofractum (Javanese long pepper).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
