BD8063431
Tos-Phe-OH , 95% , 13505-32-3
CAS NO.：13505-32-3
Empirical Formula: C16H17NO4S
Molecular Weight: 319.38
MDL number: MFCD00037251
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB63.20 | In Stock |
|
| 10g | RMB80.80 | In Stock |
|
| 25g | RMB194.40 | In Stock |
|
| 100g | RMB728.80 | In Stock |
|
| 500g | RMB2551.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165 °C |
| Boiling point: | 517.7±60.0 °C(Predicted) |
| Density | 1.303±0.06 g/cm3(Predicted) |
| refractive index | -2.8 ° (C=4.5, Acetone) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in hot EtOH |
| form | powder to crystal |
| pka | 3.31±0.10(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C16H17NO4S/c1-12-7-9-14(10-8-12)22(20,21)17-15(16(18)19)11-13-5-3-2-4-6-13/h2-10,15,17H,11H2,1H3,(H,18,19)/t15-/m0/s1 |
| InChIKey | CGRCVIZBNRUWLY-HNNXBMFYSA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=CC=C1)NS(C1=CC=C(C)C=C1)(=O)=O |
| CAS DataBase Reference | 13505-32-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Safety Statements | 24/25 |
| HazardClass | IRRITANT |
| HS Code | 29224999 |
