A6354812
<i>N</i>-(<i>p</i>-Toluenesulfonyl)glycine , ≥98.0% , 1080-44-0
Synonym(s):
N-(p-Toluenesulfonyl)glycine
CAS NO.:1080-44-0
Empirical Formula: C9H11NO4S
Molecular Weight: 229.25
MDL number: MFCD00045898
EINECS: 625-711-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB32.80 | In Stock |
|
| 5G | RMB101.60 | In Stock |
|
| 25G | RMB351.20 | In Stock |
|
| 100g | RMB1081.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 147-149 °C (lit.) |
| Boiling point: | 430.0±55.0 °C(Predicted) |
| Density | 1.369±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.41±0.10(Predicted) |
| color | White |
| Major Application | peptide synthesis |
| InChI | 1S/C9H11NO4S/c1-7-2-4-8(5-3-7)15(13,14)10-6-9(11)12/h2-5,10H,6H2,1H3,(H,11,12) |
| InChIKey | VDKFCCZUCXYILI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(cc1)S(=O)(=O)NCC(O)=O |
| CAS DataBase Reference | 1080-44-0(CAS DataBase Reference) |
Description and Uses
N-Tosylglycine is a sulfonamide derivative used to synthesize metal complexes which potentially displays antibacterial activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2935.90.9500 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







