BD8067831
N,N-Dimethyl-2-nitroaniline , 95% , 610-17-3
CAS NO.:610-17-3
Empirical Formula: C8H10N2O2
Molecular Weight: 166.18
MDL number: MFCD00043602
EINECS: 210-210-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB55.20 | In Stock |
|
| 1g | RMB137.60 | In Stock |
|
| 5g | RMB479.20 | In Stock |
|
| 25g | RMB1677.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 57-58℃ |
| Boiling point: | 258℃ |
| Density | 1.193 |
| refractive index | 1.6102 |
| Flash point: | 110℃ |
| storage temp. | 2-8°C |
| pka | 2.68±0.18(Predicted) |
| Appearance | Yellow to orange Liquid |
| InChI | InChI=1S/C8H10N2O2/c1-9(2)7-5-3-4-6-8(7)10(11)12/h3-6H,1-2H3 |
| InChIKey | NPZDNLCYFLDJFA-UHFFFAOYSA-N |
| SMILES | C1(N(C)C)=CC=CC=C1[N+]([O-])=O |
| EPA Substance Registry System | Benzenamine, N,N-dimethyl-2-nitro- (610-17-3) |
Description and Uses
N,N-Dimethyl-2-nitroaniline (cas# 610-17-3) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| TSCA | TSCA listed |
| HS Code | 2921420090 |






