BD8076131
H-Thr(tBu)-OtBu , 98% , 5854-78-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB42.40 | In Stock |
|
| 10g | RMB82.40 | In Stock |
|
| 25g | RMB176.00 | In Stock |
|
| 100g | RMB692.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 74-75 °C |
| Boiling point: | 70°C/0.8mmHg(lit.) |
| Density | 0.959±0.06 g/cm3(Predicted) |
| refractive index | 1.4320-1.4360 |
| storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C |
| form | clear liquid |
| pka | 6.14±0.33(Predicted) |
| color | Colorless to Red to Green |
| InChI | InChI=1S/C12H25NO3/c1-8(15-11(2,3)4)9(13)10(14)16-12(5,6)7/h8-9H,13H2,1-7H3/t8-,9+/m1/s1 |
| InChIKey | PPDIUNOGUIAFLV-BDAKNGLRSA-N |
| SMILES | C(OC(C)(C)C)(=O)[C@H]([C@H](OC(C)(C)C)C)N |
| CAS DataBase Reference | 5854-78-4 |
Description and Uses
O-tert-Butylthreonine tert-Butyl Ester, can be used in the synthesis of various chemical compounds having therapeutic activity, such as N-[[[(1S)-1-[3-(2-Pyrazinyl)-1,2,4-oxadiazol-5-yl]-3-butyn-1-yl]amino]carbonyl]-L-threonine (P842605), used as immune modeulators.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210-P280-P370+P378-P403+P235-P501 |
| HS Code | 2922.50.5000 |
