A1231212
O-tert-Butyl-L-threonine , 98% , 4378-13-6
CAS NO.：4378-13-6
Empirical Formula: C8H17NO3
Molecular Weight: 175.23
MDL number: MFCD00037766
EINECS: 610-143-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB71.20 | In Stock |
|
| 25G | RMB261.60 | In Stock |
|
| 100G | RMB941.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 244-247 °C |
| Boiling point: | 275℃ |
| Density | 1.055 |
| Flash point: | 120℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Solid |
| pka | 2.14±0.10(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D 43±2°, c = 1% in H2O |
| BRN | 2206127 |
| Major Application | peptide synthesis |
| InChI | 1S/C8H17NO3/c1-5(6(9)7(10)11)12-8(2,3)4/h5-6H,9H2,1-4H3,(H,10,11)/t5-,6+/m1/s1 |
| InChIKey | NMJINEMBBQVPGY-RITPCOANSA-N |
| SMILES | C[C@@H](OC(C)(C)C)[C@H](N)C(O)=O |
Description and Uses
O-tert-Butyl-L-threonine is a catalyst used in direct asymmetric Mannich, Mannich-type, and adol reaction involving unmodified α-hydroxyketones.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29241990 |
| Storage Class | 11 - Combustible Solids |
