BD8080431
4-Bromo-4'-fluoro-1,1'-biphenyl , 95% , 398-21-0
CAS NO.：398-21-0
Empirical Formula: C12H8BrF
Molecular Weight: 251.09
MDL number: MFCD00017954
EINECS: 206-909-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB27.20 | In Stock |
|
| 250mg | RMB51.20 | In Stock |
|
| 1g | RMB160.80 | In Stock |
|
| 5g | RMB704.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92.5-97.5 °C(lit.) |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| color | White to off-white |
| InChI | InChI=1S/C12H8BrF/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8H |
| InChIKey | XFGPSHWWPIFPNL-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(F)C=C2)=CC=C(Br)C=C1 |
| CAS DataBase Reference | 398-21-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Bromo-4'-fluorobiphenyl(398-21-0) |
Description and Uses
4-Bromo-4'-fluorobiphenyl is a reagent used in the preparation of 5-hydroxypyrimidine-4-carboxamide compounds for promoting erythropoietin (EPO) production.
Safety
| Symbol(GHS) |    GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H318-H410 |
| Precautionary statements | P264-P270-P273-P280-P301+P312-P305+P351+P338 |
| Hazard Codes | Xi,N |
| Risk Statements | 20/21/22-50/53-41 |
| Safety Statements | 22-36/37/39-61-60-39-26 |
| RIDADR | UN 3152 9/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 9 |
| PackingGroup | Ⅱ |
| HS Code | 2903998090 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) or 1.0 kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
