PRODUCT Properties
| Melting point: | 75-79 °C (lit.) |
| Boiling point: | 283-284 °C (lit.) |
| Density | 1.288 g/mL (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light yellow |
| Water Solubility | INSOLUBLE |
| BRN | 2042410 |
| InChI | InChI=1S/C12H9F/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H |
| InChIKey | RUYZJEIKQYLEGZ-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=C(F)C=C1 |
| CAS DataBase Reference | 324-74-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,1'-Biphenyl, 4-fluoro-(324-74-3) |
Description and Uses
4-Fluorobiphenyl is a fluorinated biphenyl compound. It undergoes biochemical degradation in the presence of various mycorrhizal fungi to afford 4-fluorobiphen-4′-ol and 4-fluorobiphen-3′-ol as major products.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-24/25 |
| WGK Germany | 3 |
| RTECS | DV5291200 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |





