PRODUCT Properties
Melting point: | 75-79 °C (lit.) |
Boiling point: | 283-284 °C (lit.) |
Density | 1.288 g/mL (lit.) |
refractive index | n |
Flash point: | >230 °F |
solubility | soluble in Methanol |
form | powder to crystal |
color | White to Light yellow |
Water Solubility | INSOLUBLE |
BRN | 2042410 |
InChI | InChI=1S/C12H9F/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H |
InChIKey | RUYZJEIKQYLEGZ-UHFFFAOYSA-N |
SMILES | C1(C2=CC=CC=C2)=CC=C(F)C=C1 |
CAS DataBase Reference | 324-74-3(CAS DataBase Reference) |
NIST Chemistry Reference | 1,1'-Biphenyl, 4-fluoro-(324-74-3) |
Safety
Symbol(GHS) | ![]() GHS07 |
Signal word | Warning |
Hazard statements | H315-H319-H335 |
Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
Hazard Codes | Xi |
Risk Statements | 36/37/38 |
Safety Statements | 37/39-26-24/25 |
WGK Germany | 3 |
RTECS | DV5291200 |
HazardClass | IRRITANT |
HS Code | 29039990 |