BD8081531
(S)-1-Benzyl 2-methyl pyrrolidine-1,2-dicarboxylate , 95% , 5211-23-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB32.00 | In Stock |
|
| 5g | RMB72.00 | In Stock |
|
| 10g | RMB138.40 | In Stock |
|
| 25g | RMB318.40 | In Stock |
|
| 100g | RMB952.80 | In Stock |
|
| 500g | RMB3655.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 375.0±42.0 °C(Predicted) |
| Density | 1.175 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| pka | -3.40±0.40(Predicted) |
| form | Liquid |
| color | Colorless to light yellow |
| optical activity | [α]22/D 36.8°, neat |
| Major Application | peptide synthesis |
| InChI | 1S/C14H17NO4/c1-18-13(16)12-8-5-9-15(12)14(17)19-10-11-6-3-2-4-7-11/h2-4,6-7,12H,5,8-10H2,1H3/t12-/m0/s1 |
| InChIKey | BLQYEDXWEDWCNJ-LBPRGKRZSA-N |
| SMILES | COC(=O)[C@@H]1CCCN1C(=O)OCc2ccccc2 |
Description and Uses
peptide synthesis






