BD8104931
2-(6-Methoxynaphthalen-2-yl)acetic acid , 97% , 23981-47-7
Synonym(s):
6-Methoxy-2-naphthaleneacetic acid;6-Methoxy-2-naphthylacetic acid;Naproxen impurity I
CAS NO.:23981-47-7
Empirical Formula: C13H12O3
Molecular Weight: 216.23
MDL number: MFCD00033105
EINECS: 245-967-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB160.00 | In Stock |
|
| 250mg | RMB265.60 | In Stock |
|
| 1g | RMB666.40 | In Stock |
|
| 5g | RMB2332.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170-172°C |
| Boiling point: | 408.8±20.0 °C(Predicted) |
| Density | 1.235 |
| RTECS | QJ1045000 |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Off-white solid. |
| pka | 4.35±0.30(Predicted) |
| color | Off-White to Yellow |
| InChI | 1S/C13H12O3/c1-16-12-5-4-10-6-9(7-13(14)15)2-3-11(10)8-12/h2-6,8H,7H2,1H3,(H,14,15) |
| InChIKey | PHJFLPMVEFKEPL-UHFFFAOYSA-N |
| SMILES | OC(CC1=CC2=CC=C(OC)C=C2C=C1)=O |
Description and Uses
A metabolite of Nabumetone. A competitive, non-selective COX inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P301+P312+P330-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xn,Xi,N |
| Risk Statements | 22-36/37/38-37/38-41-50 |
| Safety Statements | 26-39-61 |
| WGK Germany | WGK 3 |
| HS Code | 2916399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |





