BD8107631
H-D-1-Nal-OH , 97% , 78306-92-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB32.00 | In Stock |
|
| 1g | RMB73.60 | In Stock |
|
| 5g | RMB239.20 | In Stock |
|
| 10g | RMB388.00 | In Stock |
|
| 25g | RMB908.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 412.3±33.0 °C(Predicted) |
| Density | 1.254±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | 2 M HCl: 50 mg/mL, clear, yellow |
| pka | 2.21±0.30(Predicted) |
| form | Solid |
| Appearance | Off-white to light yellow Solid |
| optical activity | Consistent with structure |
| InChI | InChI=1/C13H13NO2/c14-12(13(15)16)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7,12H,8,14H2,(H,15,16)/t12-/s3 |
| InChIKey | OFYAYGJCPXRNBL-PLAQIDKDNA-N |
| SMILES | C12C=CC=CC=1C=CC=C2C[C@@H](N)C(=O)O |&1:11,r| |
| CAS DataBase Reference | 78306-92-0(CAS DataBase Reference) |
Description and Uses
3-(1-Naphthyl)-D-alanine is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P264b-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P330-P362+P364-P403+P233-P501c |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2922498590 |
