BD8143231
Quinoxaline-6-carboxylic acid , 97% , 6925-00-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB27.20 | In Stock |
|
| 1g | RMB41.60 | In Stock |
|
| 5g | RMB152.00 | In Stock |
|
| 10g | RMB292.80 | In Stock |
|
| 25g | RMB696.00 | In Stock |
|
| 100g | RMB2723.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 224-229 °C (dec.) |
| Boiling point: | 355.1±27.0 °C(Predicted) |
| Density | 1.421±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) |
| form | Solid |
| pka | 3.22±0.30(Predicted) |
| color | Light Brown to Dark Brown |
| InChI | InChI=1S/C9H6N2O2/c12-9(13)6-1-2-7-8(5-6)11-4-3-10-7/h1-5H,(H,12,13) |
| InChIKey | JGQDBVXRYDEWGM-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC(C(O)=O)=CC=2)N=CC=1 |
| CAS DataBase Reference | 6925-00-4(CAS DataBase Reference) |
Description and Uses
6-Quinoxalinecarboxylic Acid is an intermediate used in the production of antiprotozoal agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |
