BD8149531
2-(Furan-2-yl)-7-phenethyl-7H-pyrazolo[4,3-e][1,2,4]triazolo[1,5-c]pyrimidin-5-amine , 98% , 160098-96-4
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB548.80 | In Stock |
|
| 50mg | RMB932.00 | In Stock |
|
| 100mg | RMB1583.20 | In Stock |
|
| 250mg | RMB2691.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 223 °C |
| Density | 1.54±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO: >10 mg/mL, soluble |
| pka | 2.78±0.30(Predicted) |
| form | solid |
| color | off-white |
| InChI | 1S/C18H15N7O/c19-18-22-16-13(11-20-24(16)9-8-12-5-2-1-3-6-12)17-21-15(23-25(17)18)14-7-4-10-26-14/h1-7,10-11H,8-9H2,(H2,19,22) |
| InChIKey | UTLPKQYUXOEJIL-UHFFFAOYSA-N |
| SMILES | Nc1nc2n(CCc3ccccc3)ncc2c4nc(nn14)-c5ccco5 |
Description and Uses
SCH 58261 is a potent and selective A2A adenosine receptor antagonist.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 2934.99.3000 |
| Storage Class | 11 - Combustible Solids |

![2-(Furan-2-yl)-7-phenethyl-7H-pyrazolo[4,3-e][1,2,4]triazolo[1,5-c]pyrimidin-5-amine](https://img.chemicalbook.com/CAS/GIF/160098-96-4.gif)




