BD8164131
(1-(Phenylsulfonyl)-1H-indol-3-yl)boronic acid , 95% , 129271-98-3
Synonym(s):
1-(Phenylsulfonyl)-3-indoleboronic acid
CAS NO.:129271-98-3
Empirical Formula: C14H12BNO4S
Molecular Weight: 301.13
MDL number: MFCD02681892
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB157.60 | In Stock |
|
| 1g | RMB403.20 | In Stock |
|
| 5g | RMB1347.20 | In Stock |
|
| 10g | RMB2127.20 | In Stock |
|
| 25g | RMB4259.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 144 °C (dec.)(lit.) |
| Boiling point: | 581.4±60.0 °C(Predicted) |
| Density | 1.34±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 7.98±0.30(Predicted) |
| form | powder |
| color | Off-white to pale pink |
| InChI | 1S/C14H12BNO4S/c17-15(18)13-10-16(14-9-5-4-8-12(13)14)21(19,20)11-6-2-1-3-7-11/h1-10,17-18H |
| InChIKey | YKTZLHLBQGCFQX-UHFFFAOYSA-N |
| SMILES | OB(O)c1cn(c2ccccc12)S(=O)(=O)c3ccccc3 |
| CAS DataBase Reference | 129271-98-3(CAS DataBase Reference) |
Description and Uses
1-(Phenylsulfonyl)-3-indolylboronic acid can be used for chemoselective cross-coupling to form carbon-carbon bonds.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933299090 |
| Storage Class | 11 - Combustible Solids |






