BD8189431
(2-Nitrovinyl)benzene , 95% , 102-96-5
CAS NO.:102-96-5
Empirical Formula: C8H7NO2
Molecular Weight: 149.15
MDL number: MFCD00007402
EINECS: 203-066-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB56.00 | In Stock |
|
| 5g | RMB200.00 | In Stock |
|
| 10g | RMB382.40 | In Stock |
|
| 25g | RMB758.40 | In Stock |
|
| 100g | RMB2972.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55-58 °C(lit.) |
| Boiling point: | 250-260 °C(lit.) |
| Density | 1.2517 (rough estimate) |
| refractive index | 1.5320 (estimate) |
| storage temp. | Store below +30°C. |
| Appearance | Light yellow to yellow Solid |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases. May be sensitive to prolonged exposure to air. |
| InChI | 1S/C8H7NO2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H/b7-6+ |
| InChIKey | PIAOLBVUVDXHHL-VOTSOKGWSA-N |
| SMILES | [N+](=O)([O-])\C=C\c1ccccc1 |
| CAS DataBase Reference | 102-96-5(CAS DataBase Reference) |
| EPA Substance Registry System | .beta.-Nitrostyrene (102-96-5) |
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H227 |
| Precautionary statements | P501-P210-P264-P280-P370+P378-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P403+P235-P405 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | WL5460000 |
| Autoignition Temperature | 250°C |
| TSCA | TSCA listed |
| Storage Class | 6.1A - Combustible, acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 102-96-5(Hazardous Substances Data) |
| Toxicity | orl-musLDLO:710mg/kgAECTCV 14,111,85 |







![1-(BENZYLOXY)-2-METHOXY-4-[(E)-2-NITROETHENYL]BENZENE](https://img.chemicalbook.com/CAS/GIF/1860-56-6.gif)