BD8194731
Benzyl tert-butyl malonate , 95% , 72594-86-6
CAS NO.：72594-86-6
Empirical Formula: C14H18O4
Molecular Weight: 250.29
MDL number: MFCD01075175
EINECS: 639-332-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5g | RMB89.60 | In Stock |
|
| 10g | RMB153.60 | In Stock |
|
| 25g | RMB351.20 | In Stock |
|
| 100g | RMB1014.40 | In Stock |
|
| 500g | RMB3550.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 312.1±17.0 °C(Predicted) |
| Density | 1.096±0.06 g/cm3(Predicted) |
| refractive index | 1.4860 |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| pka | 11.76±0.46(Predicted) |
| color | Clear, colourless |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 5434466 |
| InChI | InChI=1S/C14H18O4/c1-14(2,3)18-13(16)9-12(15)17-10-11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3 |
| InChIKey | XKXXXODAXXAFNP-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)CC(OCC1=CC=CC=C1)=O |
| CAS DataBase Reference | 72594-86-6(CAS DataBase Reference) |
Description and Uses
Benzyl tert-butyl malonate is used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| Hazard Note | Irritant |
| HS Code | 2915390090 |
