A7654112
tert-Butyl ethyl malonate , 95% , 32864-38-3
CAS NO.：32864-38-3
Empirical Formula: C9H16O4
Molecular Weight: 188.22
MDL number: MFCD00009193
EINECS: 251-269-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB37.60 | In Stock |
|
| 25G | RMB155.20 | In Stock |
|
| 100G | RMB571.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 83-85 °C/8 mmHg (lit.) |
| Density | 0.994 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 189 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 11.86±0.46(Predicted) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Water Solubility | Miscible with most common solvents. Immiscible with water. |
| BRN | 1776681 |
| InChI | InChI=1S/C9H16O4/c1-5-12-7(10)6-8(11)13-9(2,3)4/h5-6H2,1-4H3 |
| InChIKey | OCOBFMZGRJOSOU-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)CC(OCC)=O |
| CAS DataBase Reference | 32864-38-3(CAS DataBase Reference) |
| NIST Chemistry Reference | tert-Butyl ethyl malonate(32864-38-3) |
Description and Uses
tert-Butyl ethyl malonate was used in the synthesis of polar ester-functionalized aliphatic polysulfone with remarkable thermal stability.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210-P280-P370+P378-P403+P235-P501-P210e-P280a-P370+P378a-P501a |
| Safety Statements | 23-24/25 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| HazardClass | CBL |
| HS Code | 29171900 |
| Excepted Quantities | Non-Hazardous |
