BD8198031
Triphenyl methyl olmesartan , 95% , 144690-92-6
CAS NO.:144690-92-6
Empirical Formula: C48H44N6O6
Molecular Weight: 800.9
MDL number: MFCD09954745
EINECS: 604-437-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB41.60 | In Stock |
|
| 5g | RMB134.40 | In Stock |
|
| 25g | RMB469.60 | In Stock |
|
| 100g | RMB1160.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 104-106°C |
| Boiling point: | 960.0±75.0 °C(Predicted) |
| Density | 1.26±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMF: 1 mg/ml,DMSO: 1 mg/ml |
| pka | 13.21±0.29(Predicted) |
| form | A solid |
| Appearance | White to off-white Solid |
| InChIKey | IJOPLMOXIPGJIJ-UHFFFAOYSA-N |
| SMILES | C1(CCC)N(CC2=CC=C(C3=CC=CC=C3C3N(C(C4=CC=CC=C4)(C4=CC=CC=C4)C4=CC=CC=C4)N=NN=3)C=C2)C(C(OCC2=C(C)OC(=O)O2)=O)=C(C(O)(C)C)N=1 |
| CAS DataBase Reference | 144690-92-6(CAS DataBase Reference) |
Description and Uses
Olmesartan medoxomil intermediate.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H319-H228 |
| Precautionary statements | P240-P210-P241-P264-P280-P302+P352-P370+P378-P337+P313-P305+P351+P338-P362+P364-P332+P313 |







![diethyl 2-propyl-1-((2'-(1-trityl-1H-tetrazol-5-yl)-[1,1'-biphenyl]-4-yl)methyl)-1H-imidazole-4,5-dicarboxylate](https://img.chemicalbook.com/CAS/20180629/GIF/144690-53-9.gif)