PRODUCT Properties
| Melting point: | 53-54 °C |
| Boiling point: | 503.7±50.0 °C(Predicted) |
| Density | 1.153±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in acetonitrile and chloroform |
| form | Solid |
| color | White |
| BRN | 313632 |
| InChI | 1S/C21H22O4/c1-14(2)5-4-6-15(3)9-11-24-21-19-17(10-12-23-19)13-16-7-8-18(22)25-20(16)21/h5,7-10,12-13H,4,6,11H2,1-3H3/b15-9+ |
| InChIKey | SOVNCTNQAWWYAQ-OQLLNIDSSA-N |
| SMILES | [o]1c2c(cc3c([o]cc3)c2OC\C=C(\CCC=C(C)C)/C)cc[c]1=O |
| LogP | 5.850 (est) |
Description and Uses
8-Geranyloxypsoralen is an anti-bacterial substances that were active against oral bacteria that causes dental caries and periodontitis such as Streptococcus mutans, Prevotella intermedia, and Porphyromonas gingivalis. Also, it is an β-secretase inhibitor.
