BD8246031
Methyl 5-methyloxazole-4-carboxylate , 98% , 41172-57-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB255.20 | In Stock |
|
| 1g | RMB588.80 | In Stock |
|
| 5g | RMB2070.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 45-48 |
| Boiling point: | 100 °C(Press: 7 Torr) |
| Density | 1.179±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | solid |
| pka | -1.08±0.10(Predicted) |
| color | Off-white |
| InChI | InChI=1S/C6H7NO3/c1-4-5(6(8)9-2)7-3-10-4/h3H,1-2H3 |
| InChIKey | UMYOVEXLUCPUAU-UHFFFAOYSA-N |
| SMILES | O1C(C)=C(C(OC)=O)N=C1 |
Description and Uses
5-Methyl-4-oxazolecarboxylic Acid Methyl Ester is used as a reagent in the syntheses of substituted oxazolyl-1,3,4-thiadiazoles, -1,3,4-oxadiazoles, and -1,2,4-triazoles. Also used as a reagent in the synthesis of Muscoride A.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Hazard Note | Harmful/Irritant/Keep Cold |
| HS Code | 2934999090 |






