BD8258331
Ethyl 6-chloro-3-pyridazinecarboxylate , 95% , 75680-92-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB83.20 | In Stock |
|
| 1g | RMB226.40 | In Stock |
|
| 5g | RMB758.40 | In Stock |
|
| 10g | RMB1321.60 | In Stock |
|
| 25g | RMB2766.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 147-149 °C |
| Boiling point: | 320.1±22.0 °C(Predicted) |
| Density | 1.311±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Crystalline Powder |
| pka | -0.94±0.10(Predicted) |
| color | White to off-white |
| InChI | InChI=1S/C7H7ClN2O2/c1-2-12-7(11)5-3-4-6(8)10-9-5/h3-4H,2H2,1H3 |
| InChIKey | GVSVPKDEHFOXSW-UHFFFAOYSA-N |
| SMILES | C1(C(OCC)=O)=NN=C(Cl)C=C1 |
Description and Uses
Ethyl 6-Chloropyridazine-3-carboxylate is a useful research chemical compound used in the preparation of hetero-substituted pyridazine derivatives using alkylation of chloropyridazinecarboxylate followed by cross-coupling and heterocyclization.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| HS Code | 29339980 |
