BD8282847
(R)-Benzyl2-((tert-butoxycarbonyl)amino)-3-iodopropanoate , 98% , 108957-20-6
Synonym(s):
N-(tert-Butoxycarbonyl)-3-iodo-L -alanine benzyl ester;Boc-3-iodo-L -alanine benzyl ester
CAS NO.:108957-20-6
Empirical Formula: C15H20INO4
Molecular Weight: 405.23
MDL number: MFCD00191868
EINECS: 200-258-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB190.40 | In Stock |
|
| 250mg | RMB319.20 | In Stock |
|
| 1g | RMB638.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78-80 °C(lit.) |
| Boiling point: | 460.1±40.0 °C(Predicted) |
| Density | 1.485±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 10.42±0.46(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | [α]20/D 18.0°, c = 1 in ethanol |
| Sensitive | Light Sensitive |
| BRN | 4506658 |
| Major Application | peptide synthesis |
| InChI | 1S/C15H20INO4/c1-15(2,3)21-14(19)17-12(9-16)13(18)20-10-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,17,19)/t12-/m0/s1 |
| InChIKey | DDXFSYLOWHQCEK-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CI)C(=O)OCc1ccccc1 |
| CAS DataBase Reference | 108957-20-6(CAS DataBase Reference) |
Description and Uses
N-Boc-3-iodo-L-alanine Benzyl Ester is used as a reactant in the synthesis of the angiotensin-converting enzyme Inhibitors (-)-A58365A and (-)-A58365B lactams.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P233-P260-P261-P264-P271-P280-P302+P352-P304-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P340-P362-P403-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 8 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |





