BD8308247
Methyl4-aminothiophene-3-carboxylatehydrochloride , 98% , 39978-14-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB107.20 | In Stock |
|
| 1g | RMB210.40 | In Stock |
|
| 5g | RMB606.40 | In Stock |
|
| 25g | RMB2397.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 203-204°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | Powder |
| color | Brown |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/C6H7NO2S.ClH/c1-9-6(8)4-2-10-3-5(4)7;/h2-3H,7H2,1H3;1H |
| InChIKey | JGIRDDQLZLXRKQ-UHFFFAOYSA-N |
| SMILES | C1(C(=O)OC)=CSC=C1N.Cl |
| CAS DataBase Reference | 39978-14-8(CAS DataBase Reference) |
Description and Uses
Methyl 3-aminothiophene-4-carboxylate hydrochloride is used in the preparation of ethyl (4-methoxycarbonyl)thiophene-3-carbamate by reacting with carbonochloridic acid ethyl ester.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| Hazard Note | Irritant |
| HS Code | 2934999090 |
