BD8310831
1-(6-(Dimethylamino)naphthalen-2-yl)propan-1-one , 97% , 70504-01-7
Synonym(s):
2-(Dimethylamino)-6-propionylnaphthalene;6-Propionyl-2-(dimethylamino)naphthalene;Prodan
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB208.00 | In Stock |
|
| 250mg | RMB312.00 | In Stock |
|
| 1g | RMB784.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 137 °C(lit.) |
| Boiling point: | 386.2±17.0 °C(Predicted) |
| Density | 1.084±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMF: soluble |
| pka | 4.31±0.40(Predicted) |
| form | Solid |
| color | Pale Yellow to Yellow |
| Appearance | Solid Powder |
| λmax | 362nm(EtOH)(lit.) |
| BRN | 2723587 |
| InChI | 1S/C15H17NO/c1-4-15(17)13-6-5-12-10-14(16(2)3)8-7-11(12)9-13/h5-10H,4H2,1-3H3 |
| InChIKey | MPPQGYCZBNURDG-UHFFFAOYSA-N |
| SMILES | CCC(=O)c1ccc2cc(ccc2c1)N(C)C |
Description and Uses
Prodan is a lipophilic, environment-sensitive fluorescent probe for tubulin.
Prodan is widely used as a fluorescent molecule probe because of its significant Stokes shift in polar solvents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 8-10 |
| HS Code | 2922.39.4500 |
| Storage Class | 11 - Combustible Solids |



