PRODUCT Properties
| Melting point: | 36℃ |
| Boiling point: | 108℃ (10 Torr) |
| Density | 1.112±0.06 g/cm3 (20 ºC 760 Torr) |
| refractive index | 1.5811 (589.3 nm 20℃) |
| Flash point: | 108.2±9.3℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 4.82±0.10(Predicted) |
| Appearance | Off-white to light brown Solid |
| InChI | InChI=1S/C9H11N/c10-9-5-3-8(4-6-9)7-1-2-7/h3-7H,1-2,10H2 |
| InChIKey | UBXDNWVNEZBDBN-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(C2CC2)C=C1 |
Description and Uses
4-Cyclopropylaniline is mainly used in the research and development of pharmaceuticals, pesticides and functional materials. Relying on the reactivity of the benzene ring with bromine atoms and cyano groups, it participates in organic reactions such as coupling and substitution, and is used to prepare various drug molecules, agrochemicals and organic functional derivatives containing aromatic nitrile structures.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| HS Code | 2921420090 |
