PRODUCT Properties
| Melting point: | 264 °C (dec.) (lit.) |
| Boiling point: | 495.8±45.0 °C(Predicted) |
| Density | 1.704 |
| refractive index | 1.5410 (estimate) |
| storage temp. | 2-8°C |
| pka | 2.21±0.10(Predicted) |
| form | Fine Crystalline Powder |
| color | Off-white to light beige |
| InChI | 1S/C11H11BrN2O2/c12-7-1-2-10-8(4-7)6(5-14-10)3-9(13)11(15)16/h1-2,4-5,9,14H,3,13H2,(H,15,16) |
| InChIKey | KZDNJQUJBMDHJW-UHFFFAOYSA-N |
| SMILES | NC(Cc1c[nH]c2ccc(Br)cc12)C(O)=O |
| CAS DataBase Reference | 6548-09-0(CAS DataBase Reference) |
Description and Uses
5-Bromo-DL-tryptophan can be useful in the study of genomic determinants in relation to the reactivity and regioselectivity of flavin-dependent halogenases in bacterial genomes and metagenomes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29339980 |
| Storage Class | 11 - Combustible Solids |
