BD9503747
2-Amino-3-(5-methoxy-1H-indol-3-yl)propanoicacid , 98% , 28052-84-8
CAS NO.：28052-84-8
Empirical Formula: C12H14N2O3
Molecular Weight: 234.25
MDL number: MFCD00005650
EINECS: 248-800-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB224.80 | In Stock |
|
| 250mg | RMB368.80 | In Stock |
|
| 1g | RMB920.80 | In Stock |
|
| 5g | RMB3245.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 258-261 °C (dec.)(lit.) |
| Boiling point: | 376.57°C (rough estimate) |
| Density | 1.1923 (rough estimate) |
| refractive index | 1.6660 (estimate) |
| storage temp. | -20°C |
| solubility | DMSO: 1 mg/ml; PBS (pH 7.2): 1 mg/ml |
| form | crystalline |
| color | Light yellow to yellow |
| BRN | 26781 |
| Major Application | peptide synthesis |
| InChI | 1S/C12H14N2O3/c1-17-8-2-3-11-9(5-8)7(6-14-11)4-10(13)12(15)16/h2-3,5-6,10,14H,4,13H2,1H3,(H,15,16) |
| InChIKey | KVNPSKDDJARYKK-UHFFFAOYSA-N |
| SMILES | COc1ccc2[nH]cc(CC(N)C(O)=O)c2c1 |
| CAS DataBase Reference | 28052-84-8(CAS DataBase Reference) |
Description and Uses
5-Methoxy-DL-tryptophan is a molecule produced by endothelial cells to modulate inflammatory responses and protect against systemic inflammation. It can also suppress lipopolysaccharide-induced inflammatory responses and signaling in macrophages and endotoxemic lung tissues.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
