BD8341731
3-Bromo-4-chlorobenzaldehyde , 98% , 86265-88-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB36.00 | In Stock |
|
| 10g | RMB62.40 | In Stock |
|
| 25g | RMB130.40 | In Stock |
|
| 100g | RMB465.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70℃ |
| Boiling point: | 277.8±20.0℃ (760 Torr) |
| Density | 1.698±0.06 g/cm3 (20 ºC 760 Torr) |
| Flash point: | 121.8±21.8℃ |
| storage temp. | Inert atmosphere,2-8°C |
| form | solid |
| color | White |
| InChI | InChI=1S/C7H4BrClO/c8-6-3-5(4-10)1-2-7(6)9/h1-4H |
| InChIKey | AKDABJGHOOCVKX-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(Cl)C(Br)=C1 |
Description and Uses
3-BROMO-4-CHLORO-BENZALDEHYDE can be used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2913000090 |
