BD8343831
Boc-D-beta-Homophenylalanine , 95% , 101555-61-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB80.00 | In Stock |
|
| 250mg | RMB124.00 | In Stock |
|
| 1g | RMB316.00 | In Stock |
|
| 5g | RMB1143.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 100-102oC |
| Boiling point: | 444.8±38.0 °C(Predicted) |
| Density | 1.139±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 4.43±0.10(Predicted) |
| form | Solid |
| color | Off-White |
| InChI | InChI=1/C15H21NO4/c1-15(2,3)20-14(19)16-12(10-13(17)18)9-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,16,19)(H,17,18)/t12-/s3 |
| InChIKey | ACKWQHCPHJQANL-PLAQIDKDNA-N |
| SMILES | [C@@H](CC(=O)O)(NC(=O)OC(C)(C)C)CC1=CC=CC=C1 |&1:0,r| |
| CAS DataBase Reference | 101555-61-7(CAS DataBase Reference) |
Description and Uses
Boc-D-β-homophenylalanine is used in the synthesis of dipeptidyl peptidase IV inhibitors.






