BD8354647
(R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diol , 98%99%ee , 223259-62-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB68.80 | In Stock |
|
| 250mg | RMB136.00 | In Stock |
|
| 1g | RMB395.20 | In Stock |
|
| 5g | RMB1893.60 | In Stock |
|
| 25g | RMB7143.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 156.0 to 160.0 °C |
| Boiling point: | 433.0±45.0 °C(Predicted) |
| Density | 1.34±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| pka | 9.70±0.20(Predicted) |
| color | white |
| InChI | InChI=1S/C17H16O2/c18-13-5-1-3-11-7-9-17(15(11)13)10-8-12-4-2-6-14(19)16(12)17/h1-6,18-19H,7-10H2 |
| InChIKey | YBRDFCQKQVTQKX-UHFFFAOYSA-N |
| SMILES | [C@@]12(C3=C(C=CC=C3O)CC1)C1=C(C=CC=C1O)CC2 |
Description and Uses
(R)-SPINOL is used in the synthesis of (R,R)-f-SpiroPhos (S683030).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| HS Code | 2907.29.9000 |

![(R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diol](https://img.chemicalbook.com/CAS/20150408/GIF/223259-62-9.gif)

![2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diol](https://img.chemicalbook.com/CAS2/GIF/223137-87-9.gif)
![(S)-2,2',3,3'-Tetrahydro-1,1'-spirobi[1H-indene]-7,7'-diol](https://img.chemicalbook.com/CAS/GIF/223259-63-0.gif)
![(11aR)-10,11,12,13-Tetrahydro-5-hydroxy-5-oxide-diindeno[7,1-de:1'',7''-fg][1,3,2]dioxaphosphocin](https://img.chemicalbook.com/CAS/20150408/GIF/1352810-35-5.gif)
![(11aS)-10,11,12,13-Tetrahydro-5-hydroxy-5-oxide-diindeno[7,1-de:1'',7''-fg][1,3,2]dioxaphosphocin](https://img.chemicalbook.com/CAS/20150408/GIF/1258327-03-5.gif)
