BD8361831
3-Iodo-1H-pyrazolo[3,4-b]pyridine , 97% , 117007-52-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB68.80 | In Stock |
|
| 5g | RMB285.60 | In Stock |
|
| 10g | RMB532.80 | In Stock |
|
| 25g | RMB1150.40 | In Stock |
|
| 100g | RMB3072.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 177-179°C |
| Boiling point: | 379.8±22.0 °C(Predicted) |
| Density | 2.219±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Chloroform, DMSO |
| form | Solid |
| pka | 7.96±0.40(Predicted) |
| color | Pale Yellow |
| InChI | InChI=1S/C6H4IN3/c7-5-4-2-1-3-8-6(4)10-9-5/h1-3H,(H,8,9,10) |
| InChIKey | TYXAGVKIICJXGF-UHFFFAOYSA-N |
| SMILES | C12NN=C(I)C1=CC=CN=2 |
Description and Uses
3-Iodo-7-aza-1H-azaindazole is used for preparation of azaindazole compounds as CCR1 antagonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | UN2811 |
| HS Code | 2933399990 |

![3-Iodo-1H-pyrazolo[3,4-b]pyridine](https://img.chemicalbook.com/CAS/GIF/117007-52-0.gif)


