BD8385431
Ethyl 2-(trifluoromethyl)pyrimidine-5-carboxylate , 97% , 304693-64-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB46.40 | In Stock |
|
| 1g | RMB125.60 | In Stock |
|
| 5g | RMB481.60 | In Stock |
|
| 10g | RMB937.60 | In Stock |
|
| 25g | RMB1865.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65 °C |
| Boiling point: | 194℃ |
| Density | 1.344 |
| Flash point: | 71℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder |
| pka | -3.50±0.22(Predicted) |
| color | Yellow |
| InChI | InChI=1S/C8H7F3N2O2/c1-2-15-6(14)5-3-12-7(13-4-5)8(9,10)11/h3-4H,2H2,1H3 |
| InChIKey | LRUCUGOOQHJEQP-UHFFFAOYSA-N |
| SMILES | C1(C(F)(F)F)=NC=C(C(OCC)=O)C=N1 |
Description and Uses
Ethyl 2-(Trifluoromethyl)pyrimidine-5-carboxylate is used to prepare NF-κB and AP-1 gene inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P260-P280-P271 |
| HS Code | 2933599590 |
