BD8390331
2-((2-Acetoxybenzoyl)oxy)benzoic acid , 95% , 530-75-6
Synonym(s):
2-[[2-(Acetyloxy)benzoyl]oxy]benzoic acid;2-Carboxyphenyl o-acetylsalicylate;Acetylsalicylsalicylic acid
CAS NO.:530-75-6
Empirical Formula: C16H12O6
Molecular Weight: 300.26
MDL number: MFCD00143537
EINECS: 208-493-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB164.00 | In Stock |
|
| 250mg | RMB246.40 | In Stock |
|
| 1g | RMB696.80 | In Stock |
|
| 5g | RMB2108.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-160 °C |
| Boiling point: | 361.5°C (rough estimate) |
| Density | 1.346 |
| refractive index | 1.4600 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly), DMSO (Sparingly), Methanol (Slightly) |
| pka | 2.94±0.36(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 20mg/L(21 ºC) |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C16H12O6/c1-10(17)21-14-9-5-3-7-12(14)16(20)22-13-8-4-2-6-11(13)15(18)19/h2-9H,1H3,(H,18,19) |
| InChIKey | DDSFKIFGAPZBSR-UHFFFAOYSA-N |
| SMILES | C(OC1=CC=CC=C1C(O)=O)(=O)C1=CC=CC=C1OC(C)=O |
| EPA Substance Registry System | 2-Carboxyphenyl 2-(acetyloxy)benzoate (530-75-6) |
Description and Uses
Acetylsalicylic Acid Impurity C
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |





