BD8394731
5-(Benzyloxy)-1H-indole-2-carboxylic acid , 97% , 6640-09-1
CAS NO.：6640-09-1
Empirical Formula: C16H13NO3
Molecular Weight: 267.28
MDL number: MFCD00047165
EINECS: 229-652-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB127.20 | In Stock |
|
| 1g | RMB316.80 | In Stock |
|
| 5g | RMB949.60 | In Stock |
|
| 10g | RMB1585.60 | In Stock |
|
| 25g | RMB3072.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 192 °C |
| Boiling point: | 531.1±35.0 °C(Predicted) |
| Density | 1.342±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 4.37±0.30(Predicted) |
| Appearance | Light brown to yellow Solid |
| BRN | 241643 |
| InChI | InChI=1S/C16H13NO3/c18-16(19)15-9-12-8-13(6-7-14(12)17-15)20-10-11-4-2-1-3-5-11/h1-9,17H,10H2,(H,18,19) |
| InChIKey | MVCLSAMNMAWXFQ-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(OCC3=CC=CC=C3)C=C2)C=C1C(O)=O |
| CAS DataBase Reference | 6640-09-1(CAS DataBase Reference) |
Description and Uses
5-(Benzyloxy)-1H-indole-2-carboxylic Acid is a potent type-2 specific inhibitor of human steroid 5α-reductase.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| HS Code | 2933998090 |
