BD8394947
6,6'-(Ethane-1,1-diyl)bis(2,4-di-tert-butylphenol) , 97% , 35958-30-6
CAS NO.:35958-30-6
Empirical Formula: C30H46O2
Molecular Weight: 438.68
MDL number: MFCD00075576
EINECS: 252-816-3
| Pack Size | Price | Stock | Quantity |
| 25g | RMB935.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 162-164 °C(lit.) |
| Boiling point: | 464.8±40.0 °C(Predicted) |
| Density | 0.975±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 11.28±0.50(Predicted) |
| form | solid |
| Appearance | White to off-white Solid |
| Cosmetics Ingredients Functions | ANTIOXIDANT |
| InChI | 1S/C30H46O2/c1-18(21-14-19(27(2,3)4)16-23(25(21)31)29(8,9)10)22-15-20(28(5,6)7)17-24(26(22)32)30(11,12)13/h14-18,31-32H,1-13H3 |
| InChIKey | DXCHWXWXYPEZKM-UHFFFAOYSA-N |
| SMILES | CC(c1cc(cc(c1O)C(C)(C)C)C(C)(C)C)c2cc(cc(c2O)C(C)(C)C)C(C)(C)C |
| LogP | 9.840 (est) |
| EPA Substance Registry System | Phenol, 2,2'-ethylidenebis[4,6-bis(1,1-dimethylethyl)- (35958-30-6) |
Description and Uses
Antioxidant
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






