BD8401231
(S)-5-Hydroxy-2-(4-hydroxyphenyl)-7-methoxychroman-4-one , 98% , 2957-21-3
Synonym(s):
4′-5-Dihydroxy-7-methoxyflavanone;7-O-Methylnaringenin;Naringenin 7-O-methyl ether
CAS NO.:2957-21-3
Empirical Formula: C16H14O5
Molecular Weight: 286.28
MDL number: MFCD00075651
EINECS: 220-980-5
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB311.20 | In Stock |
|
| 10mg | RMB466.40 | In Stock |
|
| 50mg | RMB1554.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-154°C |
| alpha | D16 +8.0° (c = 7.92 in acetone); D12 +8.4° (c = 6.28 in methanol) |
| Boiling point: | 555.9±50.0 °C(Predicted) |
| Density | 1.370±0.06 g/cm3(Predicted) |
| storage temp. | Store at 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 7.42±0.40(Predicted) |
| form | Solid |
| color | White to Off-White |
| Cosmetics Ingredients Functions | SKIN PROTECTING |
| InChI | InChI=1S/C16H14O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-7,14,17-18H,8H2,1H3/t14-/m0/s1 |
| InChIKey | DJOJDHGQRNZXQQ-AWEZNQCLSA-N |
| SMILES | [C@H]1(C2=CC=C(O)C=C2)OC2=CC(OC)=CC(O)=C2C(=O)C1 |
| LogP | 3.370 (est) |
Description and Uses
Sakuranetin is a flavanone phytoalexin reported to play an important role in disease resistance in rice plants. Antifungal and antimicrobial activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |





