BD8423831
2-(1-Adamantyl)-4-bromophenol , 98% , 104224-68-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB335.20 | In Stock |
|
| 5g | RMB1060.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 137-141 |
| Boiling point: | 392.0±35.0 °C(Predicted) |
| Density | 1.442±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 9.56±0.43(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C16H19BrO/c17-13-1-2-15(18)14(6-13)16-7-10-3-11(8-16)5-12(4-10)9-16/h1-2,6,10-12,18H,3-5,7-9H2 |
| InChIKey | NYJXKHIVLGWPCF-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(Br)C=C1C12CC3CC(CC(C3)C1)C2 |
| CAS DataBase Reference | 104224-68-2(CAS DataBase Reference) |
Description and Uses
2-(Adamantan-1-yl)-4-bromophenol is an intermediate in the synthesis of Adapalene (A225000), a retinoid selective for retinoic acid receptor (RAR) subtypes β and γ; an antiacne agent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Hazard Note | Irritant |
| HS Code | 2907290090 |
