BD8424731
(2R,3R,4R,5R)-2-(Acetoxymethyl)-5-(6-amino-9H-purin-9-yl)tetrahydrofuran-3,4-diyl diacetate , 98% , 7387-57-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB88.00 | In Stock |
|
| 25g | RMB284.80 | In Stock |
|
| 100g | RMB718.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168-170°C |
| Boiling point: | 594.1±60.0 °C(Predicted) |
| Density | 1.62±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | Chloroform (Sparingly), DMSO (Slightly), Methanol (Sparingly) |
| pka | 3.82±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| optical activity | -30.7°(C=0.007101g/ml CHCL3) |
| InChIKey | GCVZNVTXNUTBFB-XNIJJKJLSA-N |
| SMILES | C(OC(=O)C)[C@H]1O[C@@H](N2C3C(=C(N=CN=3)N)N=C2)[C@H](OC(=O)C)[C@@H]1OC(=O)C |
| CAS DataBase Reference | 7387-57-7(CAS DataBase Reference) |
Description and Uses
2',3',5'-Tri-O-acetyladenosine is a synthetic nucleotide analog that binds to the adenine nucleotide of DNA. It is a cross-linking agent that can be used for the preparation of insoluble complexes with other proteins or nucleic acids.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29349990 |
