BD8458531
Methyl 3-oxocyclobutanecarboxylate , 98% , 695-95-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB48.80 | In Stock |
|
| 10g | RMB92.00 | In Stock |
|
| 25g | RMB196.80 | In Stock |
|
| 100g | RMB701.60 | In Stock |
|
| 500g | RMB3436.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 188.0±33.0 °C(Predicted) |
| Density | 1.219g/ml |
| storage temp. | 2-8°C |
| form | liquid |
| color | Colourless |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C6H8O3/c1-9-6(8)4-2-5(7)3-4/h4H,2-3H2,1H3 |
| InChIKey | IHLHSAIBOSSHQV-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)CC(=O)C1 |
Description and Uses
Methyl 3-oxocyclobutanecarboxylate can be used as an intermediate for the synthesis of various pharmaceutical compounds. It is used for the preparation of novel imidazobenzazepine derivatives as dual H1/5-HT2A antagonists for the treatment of sleep disorders.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P501-P210-P280-P370+P378-P403+P235 |
| HS Code | 2918300090 |
