BD8482031
2-Chloropyrimidine-4-carboxamide , 97% , 22536-66-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB79.20 | In Stock |
|
| 250mg | RMB117.60 | In Stock |
|
| 1g | RMB259.20 | In Stock |
|
| 5g | RMB1263.20 | In Stock |
|
| 10g | RMB2268.80 | In Stock |
|
| 25g | RMB4664.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C5H4ClN3O/c6-5-8-2-1-3(9-5)4(7)10/h1-2H,(H2,7,10) |
| InChIKey | UXXQEVFRPLIOHJ-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC(C(N)=O)=N1 |
Description and Uses
2-Chloropyrimidine-4-carboxamide is used as an organic synthesis and pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P301+P312-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| HS Code | 29242990 |
