BD8489047
4'-Chloro-5,5-dimethyl-3,4,5,6-tetrahydro-[1,1'-biphenyl]-2-carbaldehyde , 96% , 1228837-05-5
| Pack Size | Price | Stock | Quantity |
| 100g | RMB1306.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 35-36°C |
| Boiling point: | 347.9±42.0 °C(Predicted) |
| Density | 1.147±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator, under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Off-White to Pale Yellow |
| InChI | InChI=1S/C15H17ClO/c1-15(2)8-7-12(10-17)14(9-15)11-3-5-13(16)6-4-11/h3-6,10H,7-9H2,1-2H3 |
| InChIKey | OOUSVDAPSBFSBR-UHFFFAOYSA-N |
| SMILES | C1(C=O)CCC(C)(C)CC=1C1=CC=C(Cl)C=C1 |
Description and Uses
2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexene-1-carboxaldehyde is an intermediate in various reactions. For example, its an intermediate in preparation of N-(phenylsulfonyl)benzamides and N-(3-pyridylsulfonyl)benzamides as apoptosis-inducing agents for the treatment of cancer and immune diseases and autoimmune diseases.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |

![4'-Chloro-5,5-dimethyl-3,4,5,6-tetrahydro-[1,1'-biphenyl]-2-carbaldehyde](https://img.chemicalbook.com/CAS/20150408/GIF/1228837-05-5.gif)


![Methyl 2-((1H-pyrrolo[2,3-b]pyridin-5-yl)oxy)-4-fluorobenzoate](https://img.chemicalbook.com/CAS/20180713/GIF/1235865-75-4.gif)

![1-(Triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridin-5-ol](https://img.chemicalbook.com/CAS/GIF/685514-01-6.gif)
![1-((4'-Chloro-5,5-dimethyl-3,4,5,6-tetrahydro-[1,1'-biphenyl]-2-yl)methyl)piperazine](https://img.chemicalbook.com/CAS/GIF/1228780-72-0.gif)