BD8525431
trans-4'-Propyl-(1,1'-bicyclohexyl)-4-carboxylic acid , 97% , 65355-32-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB48.80 | In Stock |
|
| 10g | RMB82.40 | In Stock |
|
| 25g | RMB163.20 | In Stock |
|
| 100g | RMB537.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200℃ |
| Boiling point: | 370.9±10.0 °C(Predicted) |
| Density | 0.998±0.06 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol (Sparingly) |
| form | Solid |
| pka | 4.90±0.10(Predicted) |
| color | White |
| InChI | InChI=1S/C16H28O2/c1-2-3-12-4-6-13(7-5-12)14-8-10-15(11-9-14)16(17)18/h12-15H,2-11H2,1H3,(H,17,18)/t12-,13-,14-,15- |
| InChIKey | JXPGQFKJNKWDKP-KTSLABGISA-N |
| SMILES | [C@@H]1([C@@H]2CC[C@@H](CCC)CC2)CC[C@@H](C(O)=O)CC1 |
| LogP | 6.44 |
Description and Uses
Intermediates of Liquid Crystals
Safety
| Symbol(GHS) |  GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
