BD8544631
2,5-Dichloroisonicotinaldehyde , 97% , 102645-33-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB35.20 | In Stock |
|
| 250mg | RMB43.20 | In Stock |
|
| 1g | RMB108.00 | In Stock |
|
| 5g | RMB533.60 | In Stock |
|
| 10g | RMB907.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 73-74° |
| Boiling point: | 256.3±35.0 °C(Predicted) |
| Density | 1.488±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -3.62±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C6H3Cl2NO/c7-5-2-9-6(8)1-4(5)3-10/h1-3H |
| InChIKey | UIPSRNHDSBVXHY-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(Cl)C(C=O)=C1 |
Description and Uses
2,5-Dichloro-4-pyridinecarboxaldehyde, is an intermediate in the preparation of various pharmaceutical compounds. It is used in the synthesis of 2-Amino-5-aryl-pyridines as selective CB2 agonists.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H302+H312+H332-H315 |
| Precautionary statements | P280-P301+P312 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
