BD8546831
(S)-1-Methyl-2,6-dioxohexahydropyrimidine-4-carboxylic acid , 97% , 103365-69-1
CAS NO.:103365-69-1
Empirical Formula: C6H8N2O4
Molecular Weight: 172.14
MDL number: MFCD08460215
EINECS: 600-426-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB24.80 | In Stock |
|
| 250mg | RMB32.80 | In Stock |
|
| 1g | RMB128.80 | In Stock |
|
| 5g | RMB635.20 | In Stock |
|
| 25g | RMB2230.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 212-214 °C |
| alpha | 49.2 º (c=1, DMF) |
| Density | 1.449±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMF (Sparingly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.41±0.20(Predicted) |
| color | White to Off-White |
| optical activity | Consistent with structure |
| InChI | InChI=1S/C6H8N2O4/c1-8-4(9)2-3(5(10)11)7-6(8)12/h3H,2H2,1H3,(H,7,12)(H,10,11)/t3-/m0/s1 |
| InChIKey | GWHDGNNXTNENIF-VKHMYHEASA-N |
| SMILES | C1(=O)N(C)C(=O)C[C@@H](C(O)=O)N1 |
| CAS DataBase Reference | 103365-69-1(CAS DataBase Reference) |
Description and Uses
1-Methyl-L-4,5-dihydroorotic acid is a useful research intermediate for the synthesis of other optically pure di-substituted dihydroorotic acids and other related derivatives.





