BD8552331
Methyl 3-bromoindole-6-carboxylate , 95% , 860457-92-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB24.00 | In Stock |
|
| 250mg | RMB42.40 | In Stock |
|
| 1g | RMB92.00 | In Stock |
|
| 5g | RMB384.80 | In Stock |
|
| 25g | RMB1897.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 386.2±22.0 °C(Predicted) |
| Density | 1.629 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 14.13±0.30(Predicted) |
| Appearance | Light brown to brown Solid |
| InChI | InChI=1S/C10H8BrNO2/c1-14-10(13)6-2-3-7-8(11)5-12-9(7)4-6/h2-5,12H,1H3 |
| InChIKey | YSCNGZSJIYDSOC-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC(C(OC)=O)=C2)C(Br)=C1 |
Description and Uses
Methyl 3-bromoindole-6-carboxylate is an organic synthesis intermediate, mainly used in the synthesis of indole-containing compounds, such as drugs, dyes and other chemical products.
