BD8564431
(S)-Ethyl 9,10-difluoro-3-methyl-7-oxo-3,7-dihydro-2H-[1,4]oxazino[2,3,4-ij]quinoline-6-carboxylate , 97% , 106939-34-8
CAS NO.:106939-34-8
Empirical Formula: C15H13F2NO4
Molecular Weight: 309.26
MDL number: MFCD09030626
EINECS: 691-244-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB48.00 | In Stock |
|
| 25g | RMB119.20 | In Stock |
|
| 100g | RMB298.40 | In Stock |
|
| 500g | RMB1372.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 258-260°C |
| Boiling point: | 442.2±45.0 °C(Predicted) |
| Density | 1.43±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Acetic Acid (Slightly), Chloroform (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | -3.62±0.60(Predicted) |
| color | Off-White to Light Yellow |
| InChI | InChI=1S/C15H13F2NO4/c1-3-21-15(20)9-5-18-7(2)6-22-14-11(17)10(16)4-8(12(14)18)13(9)19/h4-5,7H,3,6H2,1-2H3/t7-/m0/s1 |
| InChIKey | TZSXJUSNOOBBOP-ZETCQYMHSA-N |
| SMILES | O1C2=C(F)C(F)=CC3C(=O)C(C(OCC)=O)=CN(C2=3)[C@@H](C)C1 |
| CAS DataBase Reference | 106939-34-8 |
Description and Uses
Levofloxacin intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |

![(S)-Ethyl 9,10-difluoro-3-methyl-7-oxo-3,7-dihydro-2H-[1,4]oxazino[2,3,4-ij]quinoline-6-carboxylate](https://img.chemicalbook.com/CAS/GIF/106939-34-8.gif)



![9,10-Difluoro-2,3-dihydro-3-methyl-7-oxo-7H-pyrido[1,2,3-de]-1,4-benzoxazine-6-carboxylic Acid](https://img.chemicalbook.com/CAS/GIF/82419-35-0.gif)

![(S)-9-Fluoro-3-methyl-10-(4-methylpiperazin-1-yl)-2H-[1,4]oxazino[2,3,4-ij]quinolin-7(3H)-one](https://img.chemicalbook.com/CAS/GIF/178964-53-9.gif)